CAS 909119-73-9

4-Iodo-1-methoxy-2-(pentyloxy)benzene

Description:

4-Iodo-1-methoxy-2-(pentyloxy)benzene is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with an iodine atom, a methoxy group (-OCH3), and a pentyloxy group (-O-C5H11). The presence of the iodine atom introduces notable properties such as increased molecular weight and potential for reactivity in nucleophilic substitution reactions. The methoxy group contributes to the compound's electron-donating characteristics, enhancing its reactivity in electrophilic aromatic substitution reactions. The pentyloxy group, being a longer alkyl chain, can influence the compound's solubility and hydrophobicity, making it more lipophilic. This compound may exhibit interesting physical properties, such as a specific melting point and boiling point, which are influenced by the substituents on the benzene ring. Additionally, due to the presence of iodine, it may have applications in medicinal chemistry or materials science, particularly in the synthesis of more complex organic molecules. Overall, 4-Iodo-1-methoxy-2-(pentyloxy)benzene is a versatile compound with potential utility in various chemical applications.

Formula: C₁₂H₁₇IO₂

InChI: InChI=1/C12H17IO2/c1-3-4-5-8-15-12-9-10(13)6-7-11(12)14-2/h6-7,9H,3-5,8H2,1-2H3

SMILES: CCCCCOc1cc(ccc1OC)I