CAS 90914-41-3

3-Bromo-4-chloro-1H-pyrazolo[3,4-d]pyrimidine

Description:

3-Bromo-4-chloro-1H-pyrazolo[3,4-d]pyrimidine is a heterocyclic compound characterized by its fused pyrazole and pyrimidine rings, which contribute to its unique chemical properties. This compound features bromine and chlorine substituents, which can influence its reactivity and biological activity. Typically, such halogenated derivatives exhibit enhanced lipophilicity and can participate in various chemical reactions, including nucleophilic substitutions and cross-coupling reactions. The presence of the pyrazolo and pyrimidine moieties often imparts interesting pharmacological properties, making it a subject of interest in medicinal chemistry for potential therapeutic applications. Additionally, the compound's structure suggests it may engage in hydrogen bonding and π-π stacking interactions, which are relevant in biological systems. Its CAS number, 90914-41-3, allows for easy identification in chemical databases. Overall, 3-Bromo-4-chloro-1H-pyrazolo[3,4-d]pyrimidine is a versatile compound with potential applications in drug development and materials science.

Formula: C₅H₂BrClN₄

InChI: InChI=1/C5H2BrClN4/c6-3-2-4(7)8-1-9-5(2)11-10-3/h1H,(H,8,9,10,11)

SMILES: c1nc(c2c(Br)n[nH]c2n1)Cl

Synonyms:

• 1H-Pyrazolo[3,4-d]pyrimidine, 3-bromo-4-chloro-
• 3-bromo-4-chloro-2H-pyrazolo[3,4-d]pyrimidine

3-BROMO-4-CHLORO-1H-PYRAZOLO[3,4-D]PYRIMIDINE

CAS: 90914-41-3

Formula: C₅H₂BrClN₄

Purity: 95%

Color and Shape: Solid

Molecular weight: 233.4532

Ref: IN-DA003J1C

3-Bromo-4-chloro-1H-pyrazolo[3,4-d]pyrimidine

CAS: 90914-41-3

Purity: >95%

Molecular weight: 233.453

Ref: FT-B12960

3-Bromo-4-chloro-1H-pyrazolo[3,4-d]pyrimidine

CAS: 90914-41-3

3-Bromo-4-chloro-1H-pyrazolo[3,4-d]pyrimidine

Purity: 97%

Molecular weight: 233.45g/mol

Ref: 54-OR310169

3-Bromo-4-chloro-1H-pyrazolo[3,4-d]pyrimidine

CAS: 90914-41-3

Formula: C₅H₂BrClN₄

Purity: 95%

Color and Shape: Solid

Molecular weight: 233.45

Ref: 10-F076086