CAS 90916-54-4

2-methyl-6-(pyridin-2-yl)pyrimidin-4-amine

Description:

2-Methyl-6-(pyridin-2-yl)pyrimidin-4-amine, with the CAS number 90916-54-4, is a chemical compound characterized by its pyrimidine and pyridine moieties. This compound features a pyrimidine ring substituted at the 4-position with an amino group and at the 6-position with a pyridine ring, which contributes to its potential biological activity. The presence of the methyl group at the 2-position of the pyrimidine ring adds to its structural diversity. This compound may exhibit properties such as solubility in polar solvents, and its functional groups can participate in hydrogen bonding, influencing its reactivity and interactions with biological targets. Due to its structural characteristics, it may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its properties can be further explored through various analytical methods such as NMR, mass spectrometry, and chromatography.

Formula: C₁₀H₁₀N₄

InChI: InChI=1/C10H10N4/c1-7-13-9(6-10(11)14-7)8-4-2-3-5-12-8/h2-6H,1H3,(H2,11,13,14)

SMILES: Cc1nc(cc(=N)[nH]1)c1ccccn1