CAS 90916-55-5

2-Methyl-6-(3-pyridinyl)-4-pyrimidinamine

Description:

2-Methyl-6-(3-pyridinyl)-4-pyrimidinamine, with the CAS number 90916-55-5, is a chemical compound that belongs to the class of pyrimidines, which are heterocyclic aromatic organic compounds. This substance features a pyrimidine ring substituted with a methyl group and a pyridine moiety, contributing to its unique chemical properties. It is characterized by its potential biological activity, often investigated in the context of medicinal chemistry for its role as a pharmacophore in drug development. The presence of both pyrimidine and pyridine rings suggests that it may exhibit diverse interactions with biological targets, potentially influencing its solubility, stability, and reactivity. The compound's molecular structure allows for various functional group modifications, which can enhance its therapeutic efficacy or selectivity. As with many organic compounds, its physical properties, such as melting point, boiling point, and solubility, would depend on the specific conditions and purity of the sample. Overall, 2-Methyl-6-(3-pyridinyl)-4-pyrimidinamine is of interest in research for its potential applications in pharmaceuticals.

Formula: C₁₀H₁₀N₄

InChI: InChI=1S/C10H10N4/c1-7-13-9(5-10(11)14-7)8-3-2-4-12-6-8/h2-6H,1H3,(H2,11,13,14)

InChI key: InChIKey=LHGVTMUMGBOKEX-UHFFFAOYSA-N

SMILES: NC1=CC(=NC(C)=N1)C=2C=CC=NC2

Synonyms:

• NSC 84004
• 4-Pyrimidinamine, 2-methyl-6-(3-pyridinyl)-
• Pyrimidine, 4-amino-2-methyl-6-(3-pyridyl)-
• 2-Methyl-6-(3-pyridinyl)-4-pyrimidinamine