CAS 909185-87-1

2-Fluoro-3-iodo-4-methylbenzaldehyde

Description:

2-Fluoro-3-iodo-4-methylbenzaldehyde is an aromatic aldehyde characterized by the presence of a benzene ring substituted with a fluorine atom at the 2-position, an iodine atom at the 3-position, and a methyl group at the 4-position, along with an aldehyde functional group (-CHO). This compound typically exhibits a pale yellow to light brown appearance and is likely to be a solid at room temperature. Its molecular structure contributes to its reactivity, particularly in electrophilic aromatic substitution reactions, and it may also participate in nucleophilic addition reactions due to the aldehyde group. The presence of halogens (fluorine and iodine) can influence its chemical behavior, including its polarity and solubility in various solvents. Additionally, the compound may have applications in organic synthesis and medicinal chemistry, where halogenated aromatic compounds are often of interest for their biological activity and utility as intermediates in the synthesis of more complex molecules. Safety precautions should be observed when handling this compound due to potential toxicity associated with halogenated organic compounds.

Formula: C₈H₆FIO

InChI: InChI=1S/C8H6FIO/c1-5-2-3-6(4-11)7(9)8(5)10/h2-4H,1H3

InChI key: InChIKey=QOGXPXMPCUYQLV-UHFFFAOYSA-N

SMILES: C(=O)C1=C(F)C(I)=C(C)C=C1

Synonyms:

• Benzaldehyde, 2-fluoro-3-iodo-4-methyl-
• 2-Fluoro-3-iodo-4-methylbenzaldehyde