CAS 90921-10-1

3,4-Dihydro-4-oxo-2H-1-benzopyran-8-carboxylic acid

Description:

3,4-Dihydro-4-oxo-2H-1-benzopyran-8-carboxylic acid, with the CAS number 90921-10-1, is a chemical compound characterized by its bicyclic structure, which includes a benzopyran moiety. This compound features a carboxylic acid functional group, contributing to its acidity and potential reactivity. The presence of a keto group at the 4-position and a double bond in the benzopyran ring system enhances its chemical stability and influences its reactivity in various organic reactions. It is typically a solid at room temperature and may exhibit solubility in polar solvents due to the carboxylic acid group. The compound is of interest in medicinal chemistry and organic synthesis, potentially serving as a precursor or intermediate in the development of pharmaceuticals or agrochemicals. Its unique structural features may also impart biological activity, making it a candidate for further research in drug discovery and development. As with many organic compounds, handling should be done with care, considering safety data and potential hazards associated with its use.

Formula: C₁₀H₈O₄

InChI: InChI=1S/C10H8O4/c11-8-4-5-14-9-6(8)2-1-3-7(9)10(12)13/h1-3H,4-5H2,(H,12,13)

InChI key: InChIKey=XWMBBUVUBABHDZ-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C2C(C(=O)CCO2)=CC=C1

Synonyms:

• 3,4-Dihydro-4-oxo-2H-1-benzopyran-8-carboxylic acid
• 2H-1-Benzopyran-8-carboxylic acid, 3,4-dihydro-4-oxo-
• 8-Chromancarboxylic acid, 4-oxo-

4-Oxochroman-8-carboxylic acid

CAS: 90921-10-1

4-Oxochroman-8-carboxylic acid

Purity: 97%

Molecular weight: 192.17g/mol

Ref: 54-OR1068906

4-oxo-8-Chromancarboxylic Acid

Controlled Product

CAS: 90921-10-1

Formula: C₁₀H₈O₄

Color and Shape: Neat

Molecular weight: 192.168

Ref: TR-O849930