CAS 90921-11-2

1,7-dioxadispiro[4.0.4.2]dodeca-3,9-diene-2,8-dione

Description:

1,7-Dioxadispiro[4.0.4.2]dodeca-3,9-diene-2,8-dione, with the CAS number 90921-11-2, is a complex organic compound characterized by its unique molecular structure, which features a dioxadispiro framework. This compound contains two carbonyl (dione) functional groups, contributing to its reactivity and potential applications in organic synthesis. The presence of multiple rings and functional groups suggests that it may exhibit interesting chemical properties, such as potential for undergoing various reactions like cycloadditions or rearrangements. Additionally, the compound's structural complexity may influence its physical properties, such as solubility and melting point, which are important for practical applications. While specific data on its biological activity or industrial uses may be limited, compounds with similar structures are often explored for their potential in pharmaceuticals, materials science, and as intermediates in chemical synthesis. Further research would be necessary to fully elucidate its properties and potential applications in various fields.

Formula: C₁₀H₈O₄

InChI: InChI=1/C10H8O4/c11-7-1-3-9(13-7)5-6-10(9)4-2-8(12)14-10/h1-4H,5-6H2/t9-,10-/m1/s1

SMILES: C1=C[C@]2(CC[C@@]32C=CC(=O)O3)OC1=O

Synonyms:

• Anemonin
• 1,2-Dihydroxy-1,2-cyclobutanediacrylic Acid Di-g-lactone
• 1,7-DIOXADISPIRO(4.0.4.2)DODECA-3,9-DIENE-2,8-DIONE

1,7-Dioxadispiro[4.0.4.2]dodeca-3,9-diene-2,8-dione

CAS: 90921-11-2

Formula: C₁₀H₈O₄

Molecular weight: 192.1681

Ref: IN-DA006T48

Anemonin

CAS: 90921-11-2

Anemonin is a natural product from Pulsatilla chinensis Regel.

Formula: C₁₀H₈O₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 192.17

Ref: TM-TMA0053