CAS 90922-85-3
:2-ethoxy-4-[(E)-2-nitroethenyl]phenol
Description:
2-Ethoxy-4-[(E)-2-nitroethenyl]phenol, with the CAS number 90922-85-3, is an organic compound characterized by its phenolic structure, which includes an ethoxy group and a nitroethenyl substituent. This compound typically exhibits properties associated with both phenols and nitro compounds, such as moderate solubility in organic solvents and potential reactivity due to the presence of the nitro group. The ethoxy group enhances its lipophilicity, which may influence its biological activity and interaction with various systems. The (E)-configuration of the nitroethenyl moiety indicates a specific geometric arrangement that can affect the compound's reactivity and stability. In terms of applications, compounds of this nature may be explored for their potential use in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. However, specific safety and handling guidelines should be followed due to the presence of the nitro group, which can impart toxicity and environmental concerns. Overall, 2-ethoxy-4-[(E)-2-nitroethenyl]phenol represents a unique structure with diverse potential applications in chemical research and industry.
Formula:C10H11NO4
InChI:InChI=1/C10H11NO4/c1-2-15-10-7-8(3-4-9(10)12)5-6-11(13)14/h3-7,12H,2H2,1H3/b6-5+
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
3-Ethoxy-4-hydroxyphenylnitroethene
CAS:3-Ethoxy-4-hydroxyphenylnitroethene is a fine chemical with the CAS number 90922-85-3. It is a versatile building block that can be used for research, as a reagent, or as a speciality chemical. This compound has many applications in synthesis due to its high quality and complex nature. It is also an intermediate in the production of other compounds.Formula:C10H11NO4Purity:Min. 95%Color and Shape:PowderMolecular weight:209.2 g/mol
