CAS 90928-92-0
:(3-methyl-1,2,4-oxadiazol-5-yl)methanamine
Description:
(3-Methyl-1,2,4-oxadiazol-5-yl)methanamine is an organic compound characterized by the presence of an oxadiazole ring, which contributes to its unique chemical properties. The oxadiazole moiety is a five-membered heterocyclic structure containing two nitrogen atoms and three carbon atoms, which imparts notable stability and reactivity to the compound. The presence of the methyl group at the 3-position of the oxadiazole enhances its lipophilicity, potentially influencing its solubility and interaction with biological systems. The methanamine functional group introduces basicity to the molecule, allowing it to participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. This compound may exhibit interesting biological activities, making it a subject of interest in medicinal chemistry and material science. Its specific applications and reactivity can vary based on the surrounding conditions and the presence of other functional groups in a given reaction environment. Overall, (3-methyl-1,2,4-oxadiazol-5-yl)methanamine represents a versatile building block in organic synthesis and pharmaceutical development.
Formula:C4H7N3O
InChI:InChI=1S/C4H7N3O/c1-3-6-4(2-5)8-7-3/h2,5H2,1H3
SMILES:Cc1nc(CN)on1
Synonyms:- 1,2,4-Oxadiazole-5-Methanamine, 3-Methyl-
- 1-(3-Methyl-1,2,4-oxadiazol-5-yl)methanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-((3-Methyl-1,2,4-Oxadiazol-5-Yl))Methanamine
CAS:Formula:C4H7N3OColor and Shape:SolidMolecular weight:113.1179
