CAS 90929-73-0

2-bromo-1-(1H-pyrrolo[2,3-b]pyridin-3-yl)ethanone

Description:

2-bromo-1-(1H-pyrrolo[2,3-b]pyridin-3-yl)ethanone is a chemical compound characterized by its unique structure, which includes a bromine atom and a pyrrolopyridine moiety. This compound features a ketone functional group, contributing to its reactivity and potential applications in organic synthesis. The presence of the bromine atom enhances its electrophilic properties, making it useful in various chemical reactions, such as nucleophilic substitutions. The pyrrolopyridine structure is known for its biological activity, often serving as a scaffold in medicinal chemistry for developing pharmaceuticals. The compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular properties, including melting point, boiling point, and spectral characteristics, can vary based on purity and environmental conditions. Overall, 2-bromo-1-(1H-pyrrolo[2,3-b]pyridin-3-yl)ethanone is of interest in research fields such as drug discovery and materials science due to its structural features and potential reactivity.

Formula: C₉H₇BrN₂O

InChI: InChI=1/C9H7BrN2O/c10-4-8(13)7-5-12-9-6(7)2-1-3-11-9/h1-3,5H,4H2,(H,11,12)

SMILES: c1cc2c(c[nH]c2nc1)C(=O)CBr

Synonyms:

• 2-Brom-1-(1H-pyrrolo[2,3-b]pyridin-3-yl)ethanon

2-bromo-1-{1H-pyrrolo[2,3-b]pyridin-3-yl}ethan-1-one

CAS: 90929-73-0

Formula: C₉H₇BrN₂O

Molecular weight: 239.0687

Ref: IN-DA00H271

2-Bromo-1-{1H-pyrrolo[2,3-b]pyridin-3-yl}ethan-1-one

Controlled Product

CAS: 90929-73-0

Versatile small molecule scaffold

Formula: C₉H₇BrN₂O

Purity: Min. 95%

Molecular weight: 239.07 g/mol

Ref: 3D-QDA92973