CAS 90931-34-3
:2-Bromo-N-(5-chloro-2-pyridinyl)acetamide
Description:
2-Bromo-N-(5-chloro-2-pyridinyl)acetamide is a chemical compound characterized by its unique structure, which includes a bromine atom and a chlorine atom attached to a pyridine ring. This compound features an acetamide functional group, contributing to its reactivity and potential applications in medicinal chemistry. The presence of halogens (bromine and chlorine) often enhances the compound's biological activity and can influence its solubility and stability. Typically, compounds like this may exhibit properties such as antimicrobial or antifungal activity, making them of interest in pharmaceutical research. The molecular structure allows for various interactions with biological targets, which can be explored for therapeutic purposes. Additionally, the compound's solubility and stability in different solvents can vary, impacting its usability in various chemical reactions or formulations. Overall, 2-Bromo-N-(5-chloro-2-pyridinyl)acetamide represents a class of halogenated amides that are valuable in the development of new drugs and agrochemicals.
Formula:C7H6BrClN2O
InChI:InChI=1S/C7H6BrClN2O/c8-3-7(12)11-6-2-1-5(9)4-10-6/h1-2,4H,3H2,(H,10,11,12)
InChI key:InChIKey=XYYIHBSYADINEC-UHFFFAOYSA-N
SMILES:N(C(CBr)=O)C1=CC=C(Cl)C=N1
Synonyms:- 2-Bromo-N-(5-chloropyridin-2-yl)acetamide
- 2-Bromo-N-(5-chloro-2-pyridinyl)acetamide
- Acetamide, 2-bromo-N-(5-chloro-2-pyridinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.