CAS 90932-80-2
:(2-fluoro-4-formyl-5-hydroxy-6-methylpyridin-3-yl)methyl dihydrogen phosphate
Description:
The chemical substance "(2-fluoro-4-formyl-5-hydroxy-6-methylpyridin-3-yl)methyl dihydrogen phosphate," with the CAS number 90932-80-2, is a complex organic compound featuring a pyridine ring substituted with various functional groups. Its structure includes a fluorine atom, a formyl group, a hydroxyl group, and a methyl group, which contribute to its reactivity and potential biological activity. The presence of the dihydrogen phosphate moiety indicates that it can participate in phosphorylation reactions, making it relevant in biochemical contexts, particularly in relation to enzyme activity and metabolic pathways. The compound's solubility and stability are influenced by its polar functional groups, which may enhance its interactions with biological molecules. Additionally, the specific arrangement of substituents on the pyridine ring can affect its electronic properties and steric hindrance, potentially impacting its pharmacological profile. Overall, this compound may have applications in medicinal chemistry or as a biochemical probe, although further studies would be necessary to elucidate its specific properties and potential uses.
Formula:C8H9FNO6P
InChI:InChI=1/C8H9FNO6P/c1-4-7(12)5(2-11)6(8(9)10-4)3-16-17(13,14)15/h2,12H,3H2,1H3,(H2,13,14,15)
SMILES:Cc1c(c(C=O)c(COP(=O)(O)O)c(F)n1)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.