CAS 90936-96-2
:ethyl 2-ethyl-3-methyl-4-oxo-6-phenyl-3,4-dihydro-2H-pyran-5-carboxylate
Description:
Ethyl 2-ethyl-3-methyl-4-oxo-6-phenyl-3,4-dihydro-2H-pyran-5-carboxylate, with the CAS number 90936-96-2, is a chemical compound characterized by its complex structure, which includes a pyran ring fused with various functional groups. This compound typically exhibits properties associated with both esters and diketones, contributing to its reactivity and potential applications in organic synthesis. The presence of the ethyl and phenyl groups suggests that it may have hydrophobic characteristics, while the carboxylate moiety can impart some degree of polarity. The compound may participate in various chemical reactions, including nucleophilic substitutions and cycloadditions, making it of interest in medicinal chemistry and materials science. Its unique structure may also lead to interesting biological activities, although specific biological data would require further investigation. Overall, this compound exemplifies the diversity of organic molecules and their potential utility in various chemical applications.
Formula:C17H20O4
InChI:InChI=1/C17H20O4/c1-4-13-11(3)15(18)14(17(19)20-5-2)16(21-13)12-9-7-6-8-10-12/h6-11,13H,4-5H2,1-3H3
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
