CAS 90937-41-0
:4-Pentylphenyl 4-(trans-4-butylcyclohexyl)benzoate
Description:
4-Pentylphenyl 4-(trans-4-butylcyclohexyl)benzoate, with CAS number 90937-41-0, is an organic compound that belongs to the class of benzoates, which are esters derived from benzoic acid. This substance features a complex molecular structure characterized by a pentylphenyl group and a butylcyclohexyl moiety, contributing to its unique physical and chemical properties. Typically, compounds of this nature exhibit liquid crystalline behavior, making them of interest in the field of materials science, particularly in the development of liquid crystal displays (LCDs). The presence of long alkyl chains enhances the compound's solubility and thermal stability, while the cyclohexyl group can influence the molecular packing and phase transition temperatures. Additionally, 4-Pentylphenyl 4-(trans-4-butylcyclohexyl)benzoate may demonstrate specific optical properties, such as birefringence, which are essential for its application in optoelectronic devices. Safety and handling considerations should be observed, as with all chemical substances, to mitigate any potential hazards associated with exposure.
Formula:C28H38O2
InChI:InChI=1/C28H38O2/c1-3-5-7-9-23-12-20-27(21-13-23)30-28(29)26-18-16-25(17-19-26)24-14-10-22(11-15-24)8-6-4-2/h12-13,16-22,24H,3-11,14-15H2,1-2H3/t22-,24-
InChI key:InChIKey=QIEMVWGALIVVIT-HCGLCNNCNA-N
SMILES:C(OC1=CC=C(CCCCC)C=C1)(=O)C2=CC=C(C=C2)[C@H]3CC[C@H](CCCC)CC3
Synonyms:- 4-Pentylphenyl 4-(trans-4-butylcyclohexyl)benzoate
- Benzoic acid, 4-(4-butylcyclohexyl)-, 4-pentylphenyl ester, trans-
- Benzoic acid, 4-(trans-4-butylcyclohexyl)-, 4-pentylphenyl ester
- 4-n-Pentylphenyl trans-4-(4-n-butylcyclohexyl)benzoate, 98%
- 4-Pentylphenyl-4'-Trans-ButylcyclohexylBenzoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.