CAS 909407-14-3
:Boroxin, 2,4,6-tris([1,1′:3′,1′′-terphenyl]-5′-yl)-
Description:
Boroxin, specifically 2,4,6-tris([1,1′:3′,1′′-terphenyl]-5′-yl)-, is a boron-containing organic compound characterized by its unique structure that incorporates multiple terphenyl groups. This compound is notable for its potential applications in materials science, particularly in the development of organic semiconductors and optoelectronic devices due to its conjugated system, which can facilitate charge transport. The presence of boron in its structure may also impart interesting properties such as enhanced thermal stability and unique optical characteristics. Additionally, the terphenyl moieties contribute to the compound's rigidity and planarity, which are beneficial for solid-state applications. As with many boron-containing compounds, Boroxin may exhibit interesting reactivity and coordination chemistry, making it a subject of interest in both synthetic and applied chemistry. Its specific physical and chemical properties, such as solubility, melting point, and spectral characteristics, would typically be determined through experimental methods and may vary based on the conditions of synthesis and purification.
Formula:C54H39B3O3
InChI:InChI=1S/C54H39B3O3/c1-7-19-40(20-8-1)46-31-47(41-21-9-2-10-22-41)35-52(34-46)55-58-56(53-36-48(42-23-11-3-12-24-42)32-49(37-53)43-25-13-4-14-26-43)60-57(59-55)54-38-50(44-27-15-5-16-28-44)33-51(39-54)45-29-17-6-18-30-45/h1-39H
InChI key:InChIKey=MWZSDMFLGCWWSC-UHFFFAOYSA-N
SMILES:B1(OB(OB(O1)C2=CC(=CC(=C2)C3=CC=CC=C3)C4=CC=CC=C4)C5=CC(=CC(=C5)C6=CC=CC=C6)C7=CC=CC=C7)C8=CC(=CC(=C8)C9=CC=CC=C9)C%10=CC=CC=C%10
Synonyms:- Boroxin, 2,4,6-Tri[1,1':3',1''-Terphenyl]-5'-Yl-
- Boroxin, 2,4,6-tris([1,1′:3′,1′′-terphenyl]-5′-yl)-
- Tri-1,1':3',1''-terphenyl-5'-ylboroxin
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
