CAS 909421-70-1

ethyl 5-(3-oxocyclohexyl)thiophene-2-carboxylate

Description:

Ethyl 5-(3-oxocyclohexyl)thiophene-2-carboxylate is an organic compound characterized by its unique structure, which includes a thiophene ring, a carboxylate ester, and a cyclohexyl ketone moiety. This compound typically exhibits a moderate to high level of lipophilicity due to the presence of the cyclohexyl group, which can influence its solubility in organic solvents. The thiophene ring contributes to its potential electronic properties, making it of interest in organic electronics and materials science. Additionally, the presence of the carbonyl group in the cyclohexyl substituent may impart reactivity, allowing for further chemical modifications. Ethyl 5-(3-oxocyclohexyl)thiophene-2-carboxylate may also exhibit biological activity, which could be explored in pharmaceutical applications. Its synthesis and characterization would involve standard organic chemistry techniques, including NMR and mass spectrometry for structural confirmation. Overall, this compound represents a versatile building block for various chemical applications, particularly in the fields of organic synthesis and materials development.

Formula: C₁₃H₁₆O₃S

InChI: InChI=1/C13H16O3S/c1-2-16-13(15)12-7-6-11(17-12)9-4-3-5-10(14)8-9/h6-7,9H,2-5,8H2,1H3

InChI key: InChIKey=AZKYIXHVSIWLAY-UHFFFAOYSA-N

SMILES: CCOC(=O)c1ccc(C2CCCC(=O)C2)s1