
CAS 90943-28-5
:Ethanone, 1-(2-amino-6-methylphenyl)-, hydrochloride (1:1)
Description:
Ethanone, 1-(2-amino-6-methylphenyl)-, hydrochloride (1:1), also known by its CAS number 90943-28-5, is a chemical compound that features a phenyl ring substituted with an amino group and a methyl group, along with an ethanone moiety. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and facilitates its use in various applications, particularly in pharmaceuticals. The presence of the amino group suggests potential basic properties, while the ethanone structure indicates the presence of a carbonyl group, contributing to its reactivity. The compound may exhibit biological activity, making it of interest in medicinal chemistry, particularly in the development of therapeutic agents. Its characteristics include a specific melting point, solubility profile, and stability under certain conditions, which are essential for its practical applications. As with many organic compounds, safety data and handling precautions should be considered, especially regarding its potential effects on human health and the environment.
Formula:C9H11NO·ClH
InChI:InChI=1S/C9H11NO.ClH/c1-6-4-3-5-8(10)9(6)7(2)11;/h3-5H,10H2,1-2H3;1H
InChI key:InChIKey=AEDSJBRKBZGCPX-UHFFFAOYSA-N
SMILES:C(C)(=O)C1=C(C)C=CC=C1N.Cl
Synonyms:- Ethanone, 1-(2-amino-6-methylphenyl)-, hydrochloride (1:1)
- Acetophenone, 2′-amino-6′-methyl-, hydrochloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.