
CAS 90944-95-9
:5-Chloro-2-methoxy-N-propylbenzenamine
Description:
5-Chloro-2-methoxy-N-propylbenzenamine, with the CAS number 90944-95-9, is an organic compound characterized by its aromatic amine structure. It features a chloro group and a methoxy group attached to a benzene ring, along with a propyl chain linked to the nitrogen atom of the amine functional group. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents due to its hydrophobic propyl group and polar methoxy group. The presence of the chloro substituent can influence its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. Additionally, the amine group can participate in hydrogen bonding, affecting its physical properties such as boiling and melting points. Safety data should be consulted, as aromatic amines can pose health risks, including potential carcinogenicity. Overall, 5-Chloro-2-methoxy-N-propylbenzenamine is of interest in synthetic organic chemistry and may have applications in pharmaceuticals or agrochemicals.
Formula:C10H14ClNO
InChI:InChI=1S/C10H14ClNO/c1-3-6-12-9-7-8(11)4-5-10(9)13-2/h4-5,7,12H,3,6H2,1-2H3
InChI key:InChIKey=XAFRDFYLVWOUCF-UHFFFAOYSA-N
SMILES:N(CCC)C1=C(OC)C=CC(Cl)=C1
Synonyms:- 5-Chloro-2-methoxy-N-propylbenzenamine
- o-Anisidine, 5-chloro-N-propyl-
- Benzenamine, 5-chloro-2-methoxy-N-propyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.