CAS 90945-94-1

2-methylquinoline-4(1H)-thione

Description:

2-Methylquinoline-4(1H)-thione, with the CAS number 90945-94-1, is a heterocyclic compound that features a quinoline backbone substituted with a methyl group and a thione functional group. This compound is characterized by its aromatic structure, which contributes to its stability and potential reactivity. The presence of the thione group (–C=S) indicates that it can participate in various chemical reactions, including nucleophilic attacks and coordination with metal ions. The methyl group enhances its lipophilicity, potentially influencing its solubility and biological activity. 2-Methylquinoline-4(1H)-thione may exhibit interesting properties such as fluorescence or photochemical behavior, making it of interest in fields like organic synthesis, materials science, and medicinal chemistry. Additionally, compounds of this type can serve as ligands in coordination chemistry or as precursors in the synthesis of more complex molecules. Overall, the unique structural features of 2-methylquinoline-4(1H)-thione contribute to its versatility in various chemical applications.

Formula: C₁₀H₉NS

InChI: InChI=1/C10H9NS/c1-7-6-10(12)8-4-2-3-5-9(8)11-7/h2-6H,1H3,(H,11,12)

SMILES: Cc1cc(=S)c2ccccc2[nH]1

Synonyms:

• 4(1H)-quinolinethione, 2-methyl-
• 4-Quinolinethiol, 2-methyl-
• 2-Methylquinoline-4(1H)-thione

2-Methylquinoline-4(1h)-thione

CAS: 90945-94-1

Purity: 98%

Molecular weight: 175.25

Ref: 10-F687753