
CAS 90949-78-3
:Decahydro-7-quinolinol
Description:
Decahydro-7-quinolinol, with the CAS number 90949-78-3, is a bicyclic organic compound characterized by its unique structure that includes a quinoline moiety. This compound features a saturated decahydro framework, which contributes to its stability and solubility properties. Typically, decahydro-7-quinolinol is a colorless to pale yellow liquid or solid, depending on the temperature and purity. It is known for its potential applications in organic synthesis and as an intermediate in the production of various pharmaceuticals and agrochemicals. The presence of the hydroxyl group (-OH) in its structure imparts certain polar characteristics, enhancing its reactivity in chemical reactions, such as hydrogen bonding and nucleophilic attacks. Additionally, its molecular structure allows for various functionalization possibilities, making it a versatile compound in synthetic organic chemistry. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C9H17NO
InChI:InChI=1S/C9H17NO/c11-8-4-3-7-2-1-5-10-9(7)6-8/h7-11H,1-6H2
InChI key:InChIKey=CFYDLDXIZVAABZ-UHFFFAOYSA-N
SMILES:OC1CC2C(CC1)CCCN2
Synonyms:- 7-Quinolinol, decahydro-
- Decahydro-7-quinolinol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.