CAS 90950-44-0
:4-Piperidinebutanoic acid
Description:
4-Piperidinebutanoic acid, identified by its CAS number 90950-44-0, is an organic compound characterized by a piperidine ring attached to a butanoic acid moiety. This structure imparts both basic and acidic properties to the molecule, making it a zwitterionic compound under certain conditions. It typically appears as a white to off-white solid and is soluble in polar solvents due to the presence of the carboxylic acid group. The compound is of interest in medicinal chemistry, particularly for its potential applications in pharmaceuticals, as it may exhibit biological activity related to neurotransmitter modulation. Its synthesis often involves the reaction of piperidine derivatives with butanoic acid or its derivatives. The compound's stability, reactivity, and interaction with biological systems can vary based on environmental conditions such as pH and temperature. As with many organic acids, it may participate in various chemical reactions, including esterification and amidation, making it a versatile building block in organic synthesis. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C9H17NO2
InChI:InChI=1S/C9H17NO2/c11-9(12)3-1-2-8-4-6-10-7-5-8/h8,10H,1-7H2,(H,11,12)
InChI key:InChIKey=MSTPNVITZIFFEK-UHFFFAOYSA-N
SMILES:C(CCC(O)=O)C1CCNCC1
Synonyms:- 4-(Piperidin-4-yl)butanoic acid
- 4-(Piperidin-4-yl)butyric acid
- 4-Piperidinebutanoic Acid
- 4-Piperidinebutyric acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
