CymitQuimica logo

CAS 90950-76-8

:

γ-Aminotetrahydro-2H-pyran-2-butanoic acid

Description:
γ-Aminotetrahydro-2H-pyran-2-butanoic acid, with the CAS number 90950-76-8, is a chemical compound characterized by its unique structure that includes a pyran ring and an amino group. This compound is classified as an amino acid derivative, which suggests it may play a role in biological processes or serve as a building block for peptides. Its structure features a tetrahydro-pyran ring, contributing to its cyclic nature, and a butanoic acid moiety, which provides acidic properties. The presence of the amino group indicates potential for hydrogen bonding and reactivity, making it of interest in medicinal chemistry and drug design. The compound's solubility and stability can vary depending on environmental conditions such as pH and temperature. Additionally, its potential applications may include use in pharmaceuticals, agrochemicals, or as a synthetic intermediate in organic chemistry. Overall, γ-Aminotetrahydro-2H-pyran-2-butanoic acid is a versatile compound with significant implications in various fields of research and industry.
Formula:C9H17NO3
InChI:InChI=1S/C9H17NO3/c10-7(4-5-9(11)12)8-3-1-2-6-13-8/h7-8H,1-6,10H2,(H,11,12)
InChI key:InChIKey=ZOKALNVUYCGKCH-UHFFFAOYSA-N
SMILES:C(CCC(O)=O)(N)C1CCCCO1
Synonyms:
  • γ-Aminotetrahydro-2H-pyran-2-butanoic acid
  • 2H-Pyran-2-butanoic acid, γ-aminotetrahydro-
  • Pyran-2-butyric acid, γ-aminotetrahydro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.