
CAS 909532-61-2
:3-Bromo-N-methoxy-N-methyl-4-pyridinecarboxamide
Description:
3-Bromo-N-methoxy-N-methyl-4-pyridinecarboxamide is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a bromine atom at the 3-position of the pyridine ring introduces a halogen substituent, which can influence the compound's reactivity and biological activity. The N-methoxy and N-methyl groups attached to the nitrogen atom contribute to the compound's overall polarity and solubility in various solvents. This compound may exhibit interesting pharmacological properties due to its structural features, making it a potential candidate for research in medicinal chemistry. Additionally, the carboxamide functional group enhances hydrogen bonding capabilities, which can affect its interaction with biological targets. Overall, the unique combination of functional groups and the aromatic nature of the pyridine ring make 3-Bromo-N-methoxy-N-methyl-4-pyridinecarboxamide a compound of interest in various chemical and pharmaceutical applications.
Formula:C8H9BrN2O2
InChI:InChI=1S/C8H9BrN2O2/c1-11(13-2)8(12)6-3-4-10-5-7(6)9/h3-5H,1-2H3
InChI key:InChIKey=ZLAZSJJPVYXOGY-UHFFFAOYSA-N
SMILES:C(N(OC)C)(=O)C=1C(Br)=CN=CC1
Synonyms:- 3-Bromo-N-methyl-N-(methyloxy)-4-pyridinecarboxamide
- 3-Bromo-N-methoxy-N-methylisonicotinamide
- 4-Pyridinecarboxamide, 3-bromo-N-methoxy-N-methyl-
- 3-Bromo-N-methoxy-N-methyl-4-pyridinecarboxamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.