CAS 90968-62-0

1-(2-bromoprop-2-en-1-yl)-4-methoxybenzene

Description:

1-(2-Bromoprop-2-en-1-yl)-4-methoxybenzene, also known by its CAS number 90968-62-0, is an organic compound characterized by the presence of a methoxy group (-OCH3) attached to a benzene ring, along with a bromopropenyl substituent. This compound features a conjugated system due to the presence of the double bond in the propene moiety, which can impart unique reactivity and stability characteristics. The bromine atom introduces a halogen functionality, making it a potential electrophile in various chemical reactions, such as nucleophilic substitutions or coupling reactions. The methoxy group can influence the electronic properties of the aromatic ring, often enhancing its reactivity towards electrophiles. Additionally, the compound's structure suggests potential applications in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals. Its physical properties, such as solubility and boiling point, would typically depend on the molecular interactions and the presence of functional groups. Overall, this compound exemplifies the complexity and versatility of substituted aromatic compounds in organic chemistry.

Formula: C₁₀H₁₁BrO

InChI: InChI=1/C10H11BrO/c1-8(11)7-9-3-5-10(12-2)6-4-9/h3-6H,1,7H2,2H3

SMILES: C=C(Cc1ccc(cc1)OC)Br

Synonyms:

• 4-(2-Bromoprop-2-en-1-yl)phenyl methyl ether
• Benzene, 1-(2-bromo-2-propen-1-yl)-4-methoxy-
• 1-(2-Bromoprop-2-en-1-yl)-4-methoxybenzene