CAS 90971-89-4

2-(4-Bromo-3-methylphenoxy)acetic acid

Description:

2-(4-Bromo-3-methylphenoxy)acetic acid, with the CAS number 90971-89-4, is an organic compound characterized by its phenoxyacetic acid structure, which includes a brominated aromatic ring. This compound features a 4-bromo substituent and a 3-methyl group on the phenyl ring, contributing to its unique chemical properties. It is typically a white to off-white solid at room temperature and is soluble in organic solvents, while its solubility in water may be limited due to its hydrophobic aromatic components. The presence of the carboxylic acid functional group imparts acidic characteristics, allowing it to participate in various chemical reactions, including esterification and amidation. This compound may exhibit biological activity, making it of interest in agricultural chemistry, particularly as a potential herbicide or plant growth regulator. Its synthesis often involves the reaction of appropriate phenolic and acetic acid derivatives, and it is important to handle it with care due to potential environmental and health impacts associated with brominated compounds.

Formula: C₉H₉BrO₃

InChI: InChI=1S/C9H9BrO3/c1-6-4-7(2-3-8(6)10)13-5-9(11)12/h2-4H,5H2,1H3,(H,11,12)

InChI key: InChIKey=XBWSIQZJWUSHEH-UHFFFAOYSA-N

SMILES: O(CC(O)=O)C1=CC(C)=C(Br)C=C1

Synonyms:

• (4-Bromo-3-methyl-phenoxy)-acetic acid
• Acetic acid, [(4-bromo-m-tolyl)oxy]-
• Acetic acid, 2-(4-bromo-3-methylphenoxy)-
• 2-(4-Bromo-3-methylphenoxy)acetic acid

2-(4-Bromo-3-methylphenoxy)acetic acid

CAS: 90971-89-4

Formula: C₉H₉BrO₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 245.0700

Ref: IN-DA01BI3X

(4-Bromo-3-methylphenoxy)acetic acid

CAS: 90971-89-4

(4-Bromo-3-methylphenoxy)acetic acid

Purity: 97%

Molecular weight: 245.06996g/mol

Ref: 54-OR76766

2-(4-Bromo-3-methylphenoxy)acetic acid

CAS: 90971-89-4

Formula: C₉H₉BrO₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 245.072

Ref: 10-F042176

2-(4-Bromo-3-methylphenoxy)acetic acid

CAS: 90971-89-4

Versatile small molecule scaffold

Formula: C₉H₉BrO₃

Purity: Min. 95%

Molecular weight: 245.08 g/mol

Ref: 3D-QDA97189