CAS 90972-27-3
:ethyl (pyridin-2-yloxy)acetate
Description:
Ethyl (pyridin-2-yloxy)acetate, with the CAS number 90972-27-3, is an organic compound characterized by its ester functional group, which is formed from the reaction of ethyl alcohol and pyridin-2-yloxyacetic acid. This compound features a pyridine ring, which contributes to its aromatic properties and potential biological activity. Ethyl (pyridin-2-yloxy)acetate is typically a colorless to pale yellow liquid with a characteristic odor, making it useful in various applications, including as a solvent or in the synthesis of other chemical compounds. Its solubility in organic solvents and moderate polarity allow it to interact with a range of substances, enhancing its utility in chemical reactions. Additionally, the presence of the pyridine moiety may impart specific pharmacological properties, making it of interest in medicinal chemistry. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C9H11NO3
InChI:InChI=1/C9H11NO3/c1-2-12-9(11)7-13-8-5-3-4-6-10-8/h3-6H,2,7H2,1H3
SMILES:CCOC(=O)COc1ccccn1
Synonyms:- Acetic Acid, 2-(2-Pyridinyloxy)-, Ethyl Ester
- Ethyl (2-pyridinyloxy)acetate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
