CAS 909779-47-1
:2-[2-[4-[(S)-(4-Chlorophenyl)phenylmethyl]-1-piperazinyl]ethoxy]acetamide
Description:
2-[2-[4-[(S)-(4-Chlorophenyl)phenylmethyl]-1-piperazinyl]ethoxy]acetamide, with CAS number 909779-47-1, is a chemical compound characterized by its complex structure, which includes a piperazine ring, an ethoxy group, and an acetamide functional group. This compound is typically classified as a pharmaceutical agent and may exhibit properties relevant to its potential therapeutic applications. The presence of the 4-chlorophenyl group suggests that it may interact with biological targets, potentially influencing neurotransmitter systems or other cellular pathways. The stereochemistry indicated by the (S) configuration implies specific spatial arrangements that can affect the compound's biological activity and receptor interactions. As with many compounds in medicinal chemistry, its solubility, stability, and bioavailability are critical factors that influence its efficacy and safety profile. Further studies, including pharmacokinetic and pharmacodynamic evaluations, would be necessary to fully understand its characteristics and potential uses in clinical settings.
Formula:C21H26ClN3O2
InChI:InChI=1S/C21H26ClN3O2/c22-19-8-6-18(7-9-19)21(17-4-2-1-3-5-17)25-12-10-24(11-13-25)14-15-27-16-20(23)26/h1-9,21H,10-16H2,(H2,23,26)/t21-/m0/s1
InChI key:InChIKey=LVJDQBJDVOYDLA-NRFANRHFSA-N
SMILES:[C@@H](N1CCN(CCOCC(N)=O)CC1)(C2=CC=C(Cl)C=C2)C3=CC=CC=C3
Synonyms:- 2-[2-[4-[(S)-(4-Chlorophenyl)phenylmethyl]-1-piperazinyl]ethoxy]acetamide
- Acetamide, 2-[2-[4-[(S)-(4-chlorophenyl)phenylmethyl]-1-piperazinyl]ethoxy]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
