CAS 90985-77-6
:Ginsenoside Ra3
Description:
Ginsenoside Ra3 is a triterpenoid saponin primarily derived from Panax ginseng, a plant known for its medicinal properties. It is characterized by its complex structure, which includes a steroid-like backbone with multiple sugar moieties attached, contributing to its bioactivity. Ginsenoside Ra3 is recognized for its potential pharmacological effects, including anti-inflammatory, antioxidant, and neuroprotective properties. It is believed to modulate various signaling pathways, which may enhance cognitive function and support cardiovascular health. The compound is typically studied for its role in traditional medicine and its potential applications in modern therapeutics. Its solubility and stability can vary depending on the formulation and conditions, which is important for its bioavailability and efficacy in biological systems. As research continues, Ginsenoside Ra3 is being explored for its therapeutic potential in various health conditions, making it a subject of interest in both pharmacognosy and medicinal chemistry.
Formula:C59H100O27
InChI:InChI=1S/C59H100O27/c1-24(2)10-9-14-59(8,86-53-46(75)42(71)39(68)31(82-53)23-78-51-47(76)48(40(69)30(21-62)79-51)84-50-44(73)36(65)27(64)22-77-50)25-11-16-58(7)35(25)26(63)18-33-56(5)15-13-34(55(3,4)32(56)12-17-57(33,58)6)83-54-49(43(72)38(67)29(20-61)81-54)85-52-45(74)41(70)37(66)28(19-60)80-52/h10,25-54,60-76H,9,11-23H2,1-8H3
InChI key:InChIKey=QUNSGRLNZDSQJC-UHFFFAOYSA-N
SMILES:CC12C3(C)C(C(C(OC4OC(COC5C(O)C(OC6C(O)C(O)C(O)CO6)C(O)C(CO)O5)C(O)C(O)C4O)(CCC=C(C)C)C)CC3)C(O)CC1C7(C)C(CC2)C(C)(C)C(OC8C(OC9OC(CO)C(O)C(O)C9O)C(O)C(O)C(CO)O8)CC7
Synonyms:- Ginsenoside Ra3
- (3β,12β)-12-Hydroxy-20-[(O-β-D-xylopyranosyl-(1→3)-O-β-D-glucopyranosyl-(1→6)-β-D-glucopyranosyl)oxy]dammar-24-en-3-yl 2-O-β-D-glucopyranosyl-β-D-glucopyranoside
- β-D-Glucopyranoside, (3β,12β)-12-hydroxy-20-[(O-β-D-xylopyranosyl-(1→3)-O-β-D-glucopyranosyl-(1→6)-β-D-glucopyranosyl)oxy]dammar-24-en-3-yl 2-O-β-D-glucopyranosyl-
- Dammarane, β-D-glucopyranoside deriv.
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Ginsenoside Ra3
CAS:Ginsenoside Ra3 is a natural product isolated from Panax ginseng, has anti-cancer activity.Formula:C59H100O27Purity:99.38% - 99.83%Color and Shape:SolidMolecular weight:1241.41Ginsenoside Ra3
CAS:<p>Ginsenoside Ra3 is a bioactive compound, classified as a saponin, which is derived from the roots of the Panax species, commonly known as ginseng. This compound is part of the diverse group of ginsenosides, which are the primary active constituents contributing to the medicinal properties of ginseng. Ginsenoside Ra3 exerts its effects by modulating multiple signaling pathways, primarily involving cellular mechanisms such as anti-inflammatory, antioxidant, and immunomodulatory activities.</p>Formula:C59H100O27Purity:Min. 95%Molecular weight:1,241.42 g/mol
