CAS 909858-38-4
:3-(1-methyl-1H-pyrrol-2-yl)-1H-pyrazole-5-carboxylic acid
Description:
3-(1-Methyl-1H-pyrrol-2-yl)-1H-pyrazole-5-carboxylic acid is a chemical compound characterized by its unique structure, which includes a pyrazole ring and a pyrrole moiety. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity and solubility in organic solvents. The presence of the carboxylic acid functional group suggests it may participate in acid-base reactions and form salts. Its molecular structure allows for various interactions, including hydrogen bonding, which can influence its reactivity and stability. This compound may be of interest in medicinal chemistry due to its potential pharmacological properties, as compounds containing pyrazole and pyrrole rings are often explored for their biological activities. Additionally, the methyl group on the pyrrole ring can affect the compound's lipophilicity and overall biological profile. As with many organic compounds, its physical properties, such as melting point and solubility, would depend on the specific conditions and purity of the sample.
Formula:C9H9N3O2
InChI:InChI=1/C9H9N3O2/c1-12-4-2-3-8(12)6-5-7(9(13)14)11-10-6/h2-5H,1H3,(H,10,11)(H,13,14)
SMILES:Cn1cccc1c1cc(C(=O)O)n[nH]1
Synonyms:- 1H-pyrazole-5-carboxylic acid, 3-(1-methyl-1H-pyrrol-2-yl)-
- 3-(1-Methyl-1H-pyrrol-2-yl)-1H-pyrazole-5-carboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
5-(1-METHYL-1H-PYRROL-2-YL)-2H-PYRAZOLE-3-CARBOXYLIC ACID
CAS:Formula:C9H9N3O2Purity:97%Color and Shape:SolidMolecular weight:191.18673-(1-Methyl-1H-pyrrol-2-yl)-1H-pyrazole-5-carboxylic acid
CAS:<p>3-(1-Methyl-1H-pyrrol-2-yl)-1H-pyrazole-5-carboxylic acid is a potential drug candidate for the treatment of malaria. It is an iron chelator that may be able to disrupt the life cycle of the malaria parasite by inhibiting the growth of plasmodium falciparum. The adsorption mechanism of 3-(1-methylpyrazol-2-yl)-1H-pyrazole 5 carboxylic acid has been studied in detail and it has been found that this molecule can bind to iron ions through electrostatic interactions. In addition, 3-(1Methylpyrazol 2yl) 1H pyrazole 5 carboxylic acid has been shown to have high affinity for graphene oxide, which may make it an effective drug candidate for the treatment of malaria because it can bind to graphene oxide and inhibit its absorption in biological samples.</p>Formula:C9H9N3O2Purity:Min. 95%Molecular weight:191.19 g/mol

