CAS 90986-51-9

Janthitrem G

Description:

Janthitrem G, with the CAS number 90986-51-9, is a chemical compound that belongs to the class of alkaloids, specifically a type of indole alkaloid. It is primarily known for its occurrence in certain fungal species, particularly those within the genus Penicillium. Janthitrem G exhibits notable biological activity, including potential neurotoxic effects, which have garnered interest in pharmacological and toxicological studies. The compound is characterized by its complex molecular structure, which includes multiple rings and functional groups typical of indole derivatives. Its solubility properties can vary, influencing its behavior in biological systems and its potential applications in research. Additionally, Janthitrem G has been studied for its effects on neurotransmitter systems, making it a subject of interest in the field of neurochemistry. As with many natural products, the extraction and purification processes can be challenging, and ongoing research aims to elucidate its mechanisms of action and potential therapeutic uses.

Formula: C₃₉H₅₁NO₆

InChI: InChI=1S/C39H51NO6/c1-20(41)44-31-18-28-30(45-33(31)35(4,5)42)11-12-37(8)38(9)22(10-13-39(28,37)43)16-25-24-14-21-15-27-26(19-34(2,3)46-36(27,6)7)23(21)17-29(24)40-32(25)38/h14,17-19,22,27,30-31,33,40,42-43H,10-13,15-16H2,1-9H3/t22-,27-,30-,31+,33-,37+,38+,39+/m0/s1

InChI key: InChIKey=PGYSJEQVCATFBQ-HNUHRZRSSA-N

SMILES: C[C@@]12[C@]3(C)[C@](O)(C=4[C@](CC3)(O[C@H]([C@@](C)(C)O)[C@H](OC(C)=O)C4)[H])CC[C@]1(CC5=C2NC=6C5=CC7=C(C6)C=8[C@](C7)(C(C)(C)OC(C)(C)C8)[H])[H]

Synonyms:

• 4bH-1-Benzopyrano[5′,6′:6,7]indeno[1,2-b]pyrano[4′,3′:3,4]cyclopent[1,2-f]indole-3,4b-diol, 2,3,5,6,6a,7,9,9a,10,12,15,15b,15c,16,17,17a-hexadecahydro-2-(1-hydroxy-1-methylethyl)-10,10,12,12,15b,15c-hexamethyl-, 3-acetate, (2S,3R,4bS,6aS,9aS,15bS,15cR,17aS)-
• Janthitrem G

Janthitrem G

CAS: 90986-51-9

Janthitrem G is a type of naphthopyran. Janthitrem G is obtained from Penicillium janthinellum. Tremorgenic mycotoxi.

Formula: C₃₉H₅₁NO₆

Color and Shape: Solid

Molecular weight: 629.838

Ref: TM-T32262