CAS 90989-09-6

6,7-Dimethyl-3-oxabicyclo[3.2.0]heptane-2,4-dione

Description:

6,7-Dimethyl-3-oxabicyclo[3.2.0]heptane-2,4-dione, identified by its CAS number 90989-09-6, is a bicyclic organic compound characterized by its unique structural framework that includes a bicyclo[3.2.0]heptane core with two methyl groups at the 6 and 7 positions and a dione functional group at the 2 and 4 positions. This compound features an oxygen atom incorporated into the bicyclic structure, contributing to its reactivity and potential applications in organic synthesis. The presence of the diketone functionality suggests that it may participate in various chemical reactions, such as condensation and oxidation, making it a versatile intermediate in organic chemistry. Its molecular structure may also influence its physical properties, such as solubility and boiling point, which are typically determined by the balance of polar and nonpolar characteristics. While specific data on its physical properties may vary, compounds of this nature often exhibit interesting biological activities, making them of interest in medicinal chemistry and material science.

Formula: C₈H₁₀O₃

InChI: InChI=1S/C8H10O3/c1-3-4(2)6-5(3)7(9)11-8(6)10/h3-6H,1-2H3

InChI key: InChIKey=YFXXQXCWRNTCCY-UHFFFAOYSA-N

SMILES: CC1C2C(C1C)C(=O)OC2=O

Synonyms:

• 6,7-Dimethyl-3-oxabicyclo[3.2.0]heptane-2,4-dione
• 3-Oxabicyclo[3.2.0]heptane-2,4-dione, 6,7-dimethyl-
• 3,4-Dimethyl-cyclobutane-1,2-dicarboxylic acid anhydride
• 1,2-Cyclobutanedicarboxylic anhydride, 3,4-dimethyl-

6,7-Dimethyl-3-oxabicyclo[3.2.0]heptane-2,4-dione

CAS: 90989-09-6

Versatile small molecule scaffold

Formula: C₈H₁₀O₃

Purity: Min. 95%

Molecular weight: 154.2 g/mol

Ref: 3D-QDA98909