CAS 909900-78-3

Neoxaline

Description:

Neoxaline, identified by its CAS number 909900-78-3, is a synthetic compound that belongs to the class of heterocyclic organic compounds. It is characterized by the presence of a fused bicyclic structure, which typically includes nitrogen atoms in its ring system. Neoxaline exhibits properties that may include moderate solubility in organic solvents and potential stability under various conditions, although specific solubility and stability data can vary based on the formulation and environmental factors. This compound is often studied for its potential applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis due to its unique structural features. Additionally, neoxaline may demonstrate biological activity, making it of interest in medicinal chemistry. However, detailed information regarding its toxicity, environmental impact, and specific reactivity would require further investigation and should be approached with caution in practical applications. As with any chemical substance, proper handling and safety protocols should be observed.

Formula: C₂₃H₂₅N₅O₄

InChI: InChI=1S/C23H25N5O4/c1-5-21(2,3)22-11-18(29)20(31)27-17(10-14-12-24-13-25-14)19(30)26-23(22,27)28(32-4)16-9-7-6-8-15(16)22/h5-10,12-13,18,29H,1,11H2,2-4H3,(H,24,25)(H,26,30)/b17-10+/t18-,22-,23-/m0/s1

InChI key: InChIKey=HHLNXXASUKFCCX-FUNOPTADSA-N

SMILES: C(C=C)(C)(C)[C@]12[C@]3(N(\C(=C\C4=CN=CN4)\C(=O)N3)C(=O)[C@@H](O)C1)N(OC)C=5C2=CC=CC5

Synonyms:

• Neooxaline
• Neoxaline
• (3E,6S,7aR,12aS)-7a-(1,1-Dimethyl-2-propen-1-yl)-6,7,7a,12-tetrahydro-6-hydroxy-3-(1H-imidazol-5-ylmethylene)-12-methoxy-1H,5H-imidazo[1′,2′:1,2]pyrido[2,3-b]indole-2,5(3H)-dione
• 1H,5H-Imidazo[1′,2′:1,2]pyrido[2,3-b]indole-2,5(3H)-dione, 7a-(1,1-dimethyl-2-propenyl)-6,7,7a,12-tetrahydro-6-hydroxy-3-(1H-imidazol-4-ylmethylene)-12-methoxy-, (3E,6S,7aR,12aS)-
• 1H,5H-Imidazo[1′,2′:1,2]pyrido[2,3-b]indole-2,5(3H)-dione, 7a-(1,1-dimethyl-2-propen-1-yl)-6,7,7a,12-tetrahydro-6-hydroxy-3-(1H-imidazol-5-ylmethylene)-12-methoxy-, (3E,6S,7aR,12aS)-

Neoxaline

CAS: 909900-78-3

Formula: C₂₃H₂₅N₅O₄

Molecular weight: 435.48

Ref: 7W-GA1670

Neoxaline

CAS: 909900-78-3

Neoxaline is a bioactive compound, which is derived from natural sources, specifically certain fungal or bacterial strains. This compound functions primarily through the disruption of bacterial cell wall synthesis, where it targets specific enzymes involved in the process, leading to cell lysis and death.

Formula: C₂₃H₂₅N₅O₄

Purity: Min. 95%

Molecular weight: 435.50 g/mol

Ref: 3D-JLB90078