CymitQuimica logo

CAS 909912-12-5

:

4-Chloro-7-methoxy-3-nitro-6-(phenylmethoxy)quinoline

Description:
4-Chloro-7-methoxy-3-nitro-6-(phenylmethoxy)quinoline is a synthetic organic compound belonging to the quinoline class, characterized by a fused bicyclic structure containing a nitrogen atom. This compound features several functional groups, including a chloro group, a methoxy group, and a nitro group, which contribute to its chemical reactivity and potential biological activity. The presence of the phenylmethoxy substituent enhances its lipophilicity, potentially influencing its solubility and permeability in biological systems. The nitro group may impart specific electronic properties, making it a candidate for various chemical reactions, including reduction or nucleophilic substitution. This compound may exhibit antimicrobial or anticancer properties, as many quinoline derivatives are known for their pharmacological activities. Its unique structure and functional groups make it a subject of interest in medicinal chemistry and drug development. However, detailed studies on its specific properties, such as melting point, solubility, and biological activity, would be necessary to fully understand its potential applications.
Formula:C17H13ClN2O4
InChI:InChI=1S/C17H13ClN2O4/c1-23-15-8-13-12(17(18)14(9-19-13)20(21)22)7-16(15)24-10-11-5-3-2-4-6-11/h2-9H,10H2,1H3
InChI key:InChIKey=PLHHYMSNCNZPBQ-UHFFFAOYSA-N
SMILES:ClC=1C2=C(C=C(OC)C(OCC3=CC=CC=C3)=C2)N=CC1N(=O)=O
Synonyms:
  • 4-Chloro-7-methoxy-3-nitro-6-(phenylmethoxy)quinoline
  • Quinoline, 4-chloro-7-methoxy-3-nitro-6-(phenylmethoxy)-
  • 6-Benzyloxy-4-chloro-7-methoxy-3-nitro-quinoline
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.