CymitQuimica logo

CAS 90994-17-5

:

6-chloro-7H-pyrrolo[2,3-d]pyrimidine

Description:
6-Chloro-7H-pyrrolo[2,3-d]pyrimidine is a heterocyclic organic compound characterized by its fused pyrrole and pyrimidine rings, which contribute to its unique chemical properties. The presence of a chlorine atom at the 6-position enhances its reactivity and can influence its biological activity. This compound typically exhibits a solid-state at room temperature and is soluble in polar organic solvents. Its structure allows for potential interactions with biological targets, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The compound may also participate in various chemical reactions, such as nucleophilic substitutions or cycloadditions, due to the electron-rich nature of the pyrrole ring. Additionally, its derivatives can be synthesized to explore modifications that enhance efficacy or reduce toxicity in drug development. Overall, 6-chloro-7H-pyrrolo[2,3-d]pyrimidine serves as a valuable scaffold in organic synthesis and medicinal chemistry research.
Formula:C6H4ClN3
InChI:InChI=1/C6H4ClN3/c7-5-1-4-2-8-3-9-6(4)10-5/h1-3H,(H,8,9,10)
SMILES:c1c2c[nH]cnc2nc1Cl
Synonyms:
  • 7H-pyrrolo[2,3-d]pyrimidine, 6-chloro-
  • 6-Chloro-7H-pyrrolo[2,3-d]pyrimidine
  • 6-Chloro-3H-pyrrolo[2,3-d]pyrimidine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.