CAS 91-14-5
:1,2-Diethenylbenzene
Description:
1,2-Diethenylbenzene, also known as o-styrene or 1,2-diphenylethylene, is an organic compound characterized by its structure, which features a benzene ring with two vinyl groups (ethenyl groups) attached to adjacent carbon atoms. This compound is a colorless to pale yellow liquid with a distinct aromatic odor. It is known for its reactivity, particularly in polymerization reactions, where it can form various copolymers. The presence of the vinyl groups makes it susceptible to electrophilic addition reactions, which can lead to the formation of more complex structures. 1,2-Diethenylbenzene is relatively insoluble in water but soluble in organic solvents, making it useful in various chemical applications. It is important to handle this compound with care, as it may pose health risks upon exposure, including irritation to the skin and respiratory system. Additionally, it is classified as a flammable substance, necessitating proper storage and handling protocols to mitigate fire hazards.
Formula:C10H10
InChI:InChI=1S/C10H10/c1-3-9-7-5-6-8-10(9)4-2/h3-8H,1-2H2
InChI key:InChIKey=MYRTYDVEIRVNKP-UHFFFAOYSA-N
SMILES:C(=C)C1=C(C=C)C=CC=C1
Synonyms:- 1,2-Bis(ethenyl)benzene
- 1,2-Diethenylbenzene
- 2-Vinylstyrene
- Benzene, 1,2-diethenyl-
- Benzene, o-divinyl-
- o-Divinylbenzene
- o-Vinylstyrene
- 1,2-Divinylbenzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
