CAS 91-82-7
:Pyrrobutamine
Description:
Pyrrobutamine, with the CAS number 91-82-7, is a chemical compound that belongs to the class of organic compounds known as amines. It is characterized by its pyrrole ring structure, which is a five-membered aromatic ring containing nitrogen. Pyrrobutamine is primarily recognized for its potential pharmacological properties, particularly in the context of its stimulant effects. The compound exhibits a moderate lipophilicity, which influences its absorption and distribution in biological systems. Its molecular structure allows for interactions with various biological targets, potentially affecting neurotransmitter systems. Pyrrobutamine is often studied for its implications in enhancing physical performance and cognitive function, although its safety and efficacy in humans require further investigation. As with many amines, it may exhibit basic properties and can participate in various chemical reactions, including alkylation and acylation. Proper handling and storage are essential due to its potential reactivity and the need for safety precautions when working with chemical substances.
Formula:C20H22ClN
InChI:InChI=1/C20H22ClN/c21-20-10-8-17(9-11-20)16-19(18-6-2-1-3-7-18)12-15-22-13-4-5-14-22/h1-3,6-12H,4-5,13-16H2/b19-12+
InChI key:InChIKey=WDYYVNNRTDZKAZ-UHFFFAOYSA-N
SMILES:C(CC1=CC=C(Cl)C=C1)(=CCN2CCCC2)C3=CC=CC=C3
Synonyms:- 1-[(2E)-4-(4-chlorophenyl)-3-phenylbut-2-en-1-yl]pyrrolidine
- 1-[4-(4-Chlorophenyl)-3-phenyl-2-buten-1-yl]pyrrolidine
- Pyrrobutamine
- Pyrrolidine, 1-[4-(4-chlorophenyl)-3-phenyl-2-buten-1-yl]-
- Pyrrolidine, 1-[4-(4-chlorophenyl)-3-phenyl-2-butenyl]-
- Pyrrolidine, 1-[γ-(p-chlorobenzyl)cinnamyl]-
- 1-[4-(4-Chlorophenyl)-3-phenyl-2-butenyl]pyrrolidine
- 1-(4-(4-chlorophenyl)-3-phenylbut-2-enyl)pyrrolidine
- 1-[(E)-4-(4-chlorophenyl)-3-phenylbut-2-enyl]pyrrolidine
- 1-[γ-(p-Chlorobenzyl)cinnaMyl]pyrrolidine
- 1-[3-(4-Chlorobenzyl)-3-phenyl-2-propenyl]pyrrolidine
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Pyrrobutamine Hydrochloride
CAS:Controlled ProductApplications Antihistaminic.
References Casy, A.F., et al.: J. Pharm. Pharmacol., 22, 270 (1970),Formula:C20H22ClN•HClColor and Shape:NeatMolecular weight:311.853646
