CAS 91000-69-0
:FMOC-L-Arginine
Description:
FMOC-L-Arginine, with the CAS number 91000-69-0, is a derivative of the amino acid arginine, modified with a 9-fluorenylmethoxycarbonyl (FMOC) protecting group. This compound is primarily used in peptide synthesis, particularly in solid-phase peptide synthesis (SPPS), where the FMOC group serves to protect the amino group of arginine during the coupling reactions. The FMOC group is stable under basic conditions but can be easily removed under mildly acidic conditions, allowing for selective deprotection. FMOC-L-Arginine is characterized by its ability to form hydrogen bonds due to the presence of the guanidinium group in arginine, contributing to its solubility in polar solvents. Additionally, it exhibits basic properties due to the amino group, making it a key component in various biochemical applications. Its structure includes a side chain that can participate in ionic interactions, enhancing its role in protein structure and function. Overall, FMOC-L-Arginine is a valuable reagent in the field of peptide chemistry and biochemistry.
Formula:C21H24N4O4
InChI:InChI=1/C21H24N4O4/c22-20(23)24-11-5-10-18(19(26)27)25-21(28)29-12-17-15-8-3-1-6-13(15)14-7-2-4-9-16(14)17/h1-4,6-9,17-18H,5,10-12H2,(H,25,28)(H,26,27)(H4,22,23,24)/t18-/m1/s1
SMILES:c1ccc2c(c1)c1ccccc1C2COC(=N[C@H](CCCNC(=N)N)C(=O)O)O
Synonyms:- N-alpha-9-Fluorenylmethoxycarbonyl-L-arginine
- FMOC-Arg-OH
- N~5~-(diaminomethylidene)-N~2~-[(9H-fluoren-9-ylmethoxy)carbonyl]-L-ornithine
- N~5~-(diaminomethylidene)-N~2~-[(9H-fluoren-9-ylmethoxy)carbonyl]ornithine
- (2R)-5-[(diaminomethylidene)ammonio]-2-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}pentanoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 11 products.
Fmoc-Arg-OH
CAS:<p>Bachem ID: 4003163.</p>Formula:C21H24N4O4Purity: 99.2%Color and Shape:WhiteMolecular weight:396.45Fmoc-Arg-OH
CAS:Formula:C21H24N4O4Purity:>95.0%(T)(HPLC)Color and Shape:White to Light yellow powder to crystalMolecular weight:396.45Fmoc-Arg-OH
CAS:Formula:C21H24N4O4Purity:≥ 95.0%Color and Shape:White to off-white powder or crystalsMolecular weight:396.44Fmoc-Arg-OH
CAS:<p>Fmoc-Arg-OH (Fmoc-L-Arginine) (Fmoc-L-Arginine) is a used in peptide synthesis.</p>Formula:C21H24N4O4Purity:>99.99%Color and Shape:White SolidMolecular weight:396.44α-Fmoc-L-arginine
CAS:<p>Alfa-Fmoc-L-arginine is a synthetic amino acid that has been shown to have biological properties. It is also a precursor to the industrial preparation of polymers and pharmaceuticals. Alfa-Fmoc-L-arginine has been used in studies on heart function, as it can be converted into nitric oxide, which helps regulate blood pressure and circulation. This molecule has also been shown to have an anticancer activity. The anticancer activity may be due to its ability to inhibit the production of survivin, which is an inhibitor of apoptosis. Alfa-Fmoc-L-arginine also has acidic and nucleophilic attack properties that allow it to react with carbonyl oxygens in fatty acids. This reaction leads to the formation of a molecule with two carboxylic acids which are polar molecules that are soluble in water.</p>Formula:C21H24N4O4Purity:Min. 95%Color and Shape:SolidMolecular weight:396.44 g/molFmoc-Arg-OH
CAS:<p>M03403 - Fmoc-Arg-OH</p>Formula:C21H24N4O4Purity:95%Color and Shape:SolidMolecular weight:396.447FMOC-L-Arginine extrapure, 98%
CAS:Formula:C21H24N4O4Purity:min. 98%Color and Shape:White, Crystalline powderMolecular weight:396.45N α-Fmoc-L-arginine
CAS:<p>Applications Nα-Fmoc-L-arginine is an N-Fmoc-protected form of L-Arginine (A769505). L-Arginine is an conditionally essential amino acid for humans and adult mammals as it’s requirements exceed production during certain developmental stages in life (such as pregnancy). L-Arginine also prevents blood toxicity from intravenous amino acid administration in humans.<br>References Bronte, V. & Zanovello, P.: Nat. Rev. Immun., 5, 641 (2005); Fahey, J.: J .Clin. Invest., 36, 1647 (1957)<br></p>Formula:C21H24N4O4Color and Shape:NeatMolecular weight:396.44
