CAS 910036-91-8

3-[(4-methyl-1,4-diazepan-1-yl)methyl]benzonitrile

Description:

3-[(4-Methyl-1,4-diazepan-1-yl)methyl]benzonitrile, with the CAS number 910036-91-8, is a chemical compound characterized by its unique structure, which includes a benzonitrile moiety and a 1,4-diazepane ring. The presence of the benzonitrile group indicates that it contains a cyano functional group (-C≡N) attached to a benzene ring, contributing to its potential reactivity and solubility properties. The 1,4-diazepane ring, which is a seven-membered heterocyclic compound containing two nitrogen atoms, imparts specific pharmacological properties, making it of interest in medicinal chemistry. This compound may exhibit various biological activities, potentially acting as a ligand for certain receptors or enzymes. Its molecular structure suggests it could participate in hydrogen bonding and other intermolecular interactions, influencing its physical properties such as melting point, boiling point, and solubility in different solvents. Overall, 3-[(4-methyl-1,4-diazepan-1-yl)methyl]benzonitrile is a compound of interest for further research in both synthetic and medicinal chemistry contexts.

Formula: C₁₄H₁₉N₃

InChI: InChI=1/C14H19N3/c1-16-6-3-7-17(9-8-16)12-14-5-2-4-13(10-14)11-15/h2,4-5,10H,3,6-9,12H2,1H3

SMILES: CN1CCCN(CC1)Cc1cccc(c1)C#N

3-[(4-Methylhomopiperazin-1-yl)methyl]benzonitrile

CAS: 910036-91-8

3-[(4-Methylhomopiperazin-1-yl)methyl]benzonitrile

Purity: ≥95%

Ref: 54-OR12366