CymitQuimica logo

CAS 910037-00-2

:

1-isocyanato-2-(phenoxymethyl)benzene

Description:
1-Isocyanato-2-(phenoxymethyl)benzene, identified by its CAS number 910037-00-2, is an organic compound characterized by the presence of an isocyanate functional group (-N=C=O) attached to a benzene ring that also features a phenoxymethyl substituent. This compound typically exhibits properties associated with isocyanates, such as being reactive towards nucleophiles, which can lead to the formation of ureas or other derivatives upon reaction with amines or alcohols. The phenoxymethyl group contributes to its solubility and potential interactions in various chemical environments. Additionally, due to the isocyanate functionality, this compound may pose health risks, including respiratory irritation and sensitization, necessitating careful handling and appropriate safety measures in laboratory or industrial settings. Its applications may span across fields such as polymer chemistry, where it could be utilized in the synthesis of specialty polymers or coatings. Overall, the unique structure of 1-isocyanato-2-(phenoxymethyl)benzene allows for diverse reactivity and potential utility in various chemical processes.
Formula:C14H11NO2
InChI:InChI=1/C14H11NO2/c16-11-15-14-9-5-4-6-12(14)10-17-13-7-2-1-3-8-13/h1-9H,10H2
SMILES:c1ccc(cc1)OCc1ccccc1N=C=O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.