CAS 910037-03-5

N,N-dimethyl-3-[3-(methylaminomethyl)phenoxy]propan-1-amine

Description:

N,N-Dimethyl-3-[3-(methylaminomethyl)phenoxy]propan-1-amine is a chemical compound characterized by its complex structure, which includes a propanamine backbone, a dimethylamino group, and a phenoxy moiety. This compound features a phenyl ring substituted with a methylaminomethyl group, contributing to its potential biological activity. It is typically classified as an organic amine and may exhibit properties such as basicity due to the presence of nitrogen atoms. The compound's molecular structure suggests it could interact with various biological targets, making it of interest in medicinal chemistry and pharmacology. Its solubility and stability in different solvents can vary, influencing its application in research and development. Additionally, safety and handling precautions are essential, as with many amines, due to potential toxicity and reactivity. Overall, N,N-dimethyl-3-[3-(methylaminomethyl)phenoxy]propan-1-amine represents a unique chemical entity with potential applications in various fields, including drug development and chemical synthesis.

Formula: C₁₃H₂₂N₂O

InChI: InChI=1/C13H22N2O/c1-14-11-12-6-4-7-13(10-12)16-9-5-8-15(2)3/h4,6-7,10,14H,5,8-9,11H2,1-3H3

SMILES: CNCc1cccc(c1)OCCCN(C)C

3-[3-(Dimethylamino)propoxy]-N-methylbenzylamine 97%

CAS: 910037-03-5

3-[3-(Dimethylamino)propoxy]-N-methylbenzylamine 97%

Purity: 97%

Ref: 54-OR12227