CAS 910037-04-6

N,N-dimethyl-3-[4-(methylaminomethyl)phenoxy]propan-1-amine

Description:

N,N-Dimethyl-3-[4-(methylaminomethyl)phenoxy]propan-1-amine, with the CAS number 910037-04-6, is a chemical compound characterized by its complex structure, which includes a propan-1-amine backbone substituted with a dimethylamino group and a phenoxy group. This compound features a phenyl ring that is further substituted with a methylaminomethyl group, contributing to its potential biological activity. It is typically a colorless to pale yellow liquid or solid, depending on its form and purity. The presence of both amine and ether functional groups suggests that it may exhibit basic properties and could participate in hydrogen bonding. This compound may be of interest in medicinal chemistry and pharmacology due to its potential interactions with biological systems. Its solubility in organic solvents and possible reactivity with various electrophiles or nucleophiles could also be relevant for synthetic applications. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper laboratory practices.

Formula: C₁₃H₂₂N₂O

InChI: InChI=1/C13H22N2O/c1-14-11-12-5-7-13(8-6-12)16-10-4-9-15(2)3/h5-8,14H,4,9-11H2,1-3H3

SMILES: CNCc1ccc(cc1)OCCCN(C)C

Synonyms:

• 4-[3-(Dimethylamino)propoxy]-N-methylbenzylamine

4-[3-(Dimethylamino)propoxy]-N-methylbenzylamine

CAS: 910037-04-6

4-[3-(Dimethylamino)propoxy]-N-methylbenzylamine

Purity: ≥95%

Color and Shape: Light Yellow Liquid

Molecular weight: 222.33g/mol

Ref: 54-OR12228