CAS 910037-07-9

4-(Hexahydro-4-methyl-1H-1,4-diazepin-1-yl)-N-methylbenzenemethanamine

Description:

4-(Hexahydro-4-methyl-1H-1,4-diazepin-1-yl)-N-methylbenzenemethanamine, with the CAS number 910037-07-9, is a chemical compound characterized by its complex structure, which includes a hexahydro-1,4-diazepine ring and a N-methylbenzenemethanamine moiety. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility and reactivity. The presence of the diazepine ring suggests potential pharmacological activity, as many compounds with similar structures are known to interact with neurotransmitter systems. Its molecular configuration may also impart specific stereochemical properties, affecting its biological interactions. Additionally, the compound's stability, melting point, and solubility in various solvents would depend on its specific functional groups and overall molecular architecture. As with many organic compounds, safety and handling precautions are essential, particularly due to potential toxicity or reactivity associated with amine groups. Further studies would be necessary to fully elucidate its properties and potential applications in medicinal chemistry or other fields.

Formula: C₁₄H₂₃N₃

InChI: InChI=1S/C14H23N3/c1-15-12-13-4-6-14(7-5-13)17-9-3-8-16(2)10-11-17/h4-7,15H,3,8-12H2,1-2H3

InChI key: InChIKey=NOEOYDRQGMQWID-UHFFFAOYSA-N

SMILES: C(NC)C1=CC=C(C=C1)N2CCN(C)CCC2

Synonyms:

• 4-(Hexahydro-4-methyl-1H-1,4-diazepin-1-yl)-N-methylbenzenemethanamine
• Benzenemethanamine, 4-(hexahydro-4-methyl-1H-1,4-diazepin-1-yl)-N-methyl-
• N-methyl-4-(4-methylperhydro-1,4-diazepin-1-yl)benzylamine