CymitQuimica logo

CAS 910037-09-1

:

3-(1-Methyl-1H-pyrazol-3-yl)benzenemethanol

Description:
3-(1-Methyl-1H-pyrazol-3-yl)benzenemethanol, identified by its CAS number 910037-09-1, is an organic compound characterized by the presence of a pyrazole ring and a benzyl alcohol moiety. The structure features a pyrazole group substituted at the 3-position with a methyl group, which contributes to its unique chemical properties. This compound is likely to exhibit moderate polarity due to the hydroxyl (-OH) group in the benzyl alcohol part, influencing its solubility in various solvents. The presence of both aromatic and heterocyclic components suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as pyrazole derivatives are known for their biological activity. Additionally, the compound may participate in hydrogen bonding due to the hydroxyl group, affecting its reactivity and interaction with other molecules. Overall, 3-(1-Methyl-1H-pyrazol-3-yl)benzenemethanol represents a versatile structure with potential implications in various chemical and biological contexts.
Formula:C11H12N2O
InChI:InChI=1S/C11H12N2O/c1-13-6-5-11(12-13)10-4-2-3-9(7-10)8-14/h2-7,14H,8H2,1H3
InChI key:InChIKey=IFFXGZCJGGVFOF-UHFFFAOYSA-N
SMILES:C(O)C=1C=C(C=CC1)C2=NN(C)C=C2
Synonyms:
  • 3-(1-Methyl-1H-pyrazol-3-yl)benzenemethanol
  • Benzenemethanol, 3-(1-methyl-1H-pyrazol-3-yl)-
  • [3-(1-Methyl-1H-pyrazol-3-yl)phenyl]methanol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.