CAS 910037-13-7

4-methyl-2,3-dihydropyrido[3,2-b][1,4]oxazine-7-sulfonyl chloride

Description:

4-Methyl-2,3-dihydropyrido[3,2-b][1,4]oxazine-7-sulfonyl chloride is a chemical compound characterized by its complex bicyclic structure, which includes a pyridine and an oxazine ring. This compound features a sulfonyl chloride functional group, which is known for its reactivity, particularly in nucleophilic substitution reactions. The presence of the methyl group at the 4-position contributes to its unique chemical properties and potential applications in organic synthesis. Typically, sulfonyl chlorides are utilized as intermediates in the synthesis of various pharmaceuticals and agrochemicals due to their ability to form sulfonamides and other derivatives. The compound's molecular structure suggests it may exhibit specific biological activities, although detailed studies would be necessary to elucidate its pharmacological profile. Additionally, handling this compound requires caution due to the reactivity of the sulfonyl chloride group, which can release hydrochloric acid upon reaction with water or alcohols. Overall, 4-methyl-2,3-dihydropyrido[3,2-b][1,4]oxazine-7-sulfonyl chloride represents a valuable entity in the field of synthetic organic chemistry.

Formula: C₈H₉ClN₂O₃S

InChI: InChI=1/C8H9ClN2O3S/c1-11-2-3-14-7-4-6(15(9,12)13)5-10-8(7)11/h4-5H,2-3H2,1H3

SMILES: CN1CCOc2cc(cnc12)S(=O)(=O)Cl

3,4-Dihydro-4-methyl-2H-pyrido[3,2-b][1,4]oxazine-7-sulphonyl chloride

CAS: 910037-13-7

3,4-Dihydro-4-methyl-2H-pyrido[3,2-b][1,4]oxazine-7-sulphonyl chloride

Purity: 97%

Molecular weight: 248.69g/mol

Ref: 54-OR17847