CAS 910037-24-0

N-Methyl-3-(phenoxymethyl)benzenemethanamine

Description:

N-Methyl-3-(phenoxymethyl)benzenemethanamine is an organic compound characterized by its complex structure, which includes a benzene ring substituted with a phenoxymethyl group and a methylamino group. This compound features a tertiary amine due to the presence of the N-methyl group, which can influence its solubility and reactivity. The phenoxymethyl moiety contributes to its potential as a ligand in coordination chemistry or as a building block in organic synthesis. The presence of both aromatic and aliphatic components in its structure may impart unique electronic properties, making it of interest in medicinal chemistry and material science. Additionally, the compound's specific interactions with biological systems or its potential pharmacological applications would depend on its ability to engage in hydrogen bonding, hydrophobic interactions, and other molecular interactions. As with many organic compounds, safety and handling precautions should be observed, particularly regarding its potential toxicity and reactivity. Further studies would be necessary to fully elucidate its properties and applications.

Formula: C₁₅H₁₇NO

InChI: InChI=1S/C15H17NO/c1-16-11-13-6-5-7-14(10-13)12-17-15-8-3-2-4-9-15/h2-10,16H,11-12H2,1H3

InChI key: InChIKey=SJJAAVHTAVKEJT-UHFFFAOYSA-N

SMILES: C(OC1=CC=CC=C1)C2=CC(CNC)=CC=C2

Synonyms:

• Benzenemethanamine, N-methyl-3-(phenoxymethyl)-
• N-Methyl-3-(phenoxymethyl)benzenemethanamine
• N-methyl-3-(phenoxymethyl)benzylamine