CAS 910037-25-1

1-thieno[3,2-d]pyrimidin-4-ylpiperidine-4-carboxylic acid

Description:

1-Thieno[3,2-d]pyrimidin-4-ylpiperidine-4-carboxylic acid is a chemical compound characterized by its unique bicyclic structure, which includes a thieno[3,2-d]pyrimidine moiety fused to a piperidine ring. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity due to its ability to interact with various biological targets. The presence of the carboxylic acid functional group suggests it may exhibit acidic properties and participate in hydrogen bonding, influencing its solubility and reactivity. Additionally, the piperidine ring contributes to its basicity and may enhance its pharmacological profile. The compound's structure allows for various substitutions, which can affect its lipophilicity and overall biological activity. As a result, compounds like this are often explored in medicinal chemistry for their potential therapeutic applications, particularly in areas such as neuropharmacology or oncology. Overall, 1-thieno[3,2-d]pyrimidin-4-ylpiperidine-4-carboxylic acid represents a class of compounds with significant interest in drug discovery and development.

Formula: C₁₂H₁₃N₃O₂S

InChI: InChI=1/C12H13N3O2S/c16-12(17)8-1-4-15(5-2-8)11-10-9(3-6-18-10)13-7-14-11/h3,6-8H,1-2,4-5H2,(H,16,17)

SMILES: C1CN(CCC1C(=O)O)c1c2c(ccs2)ncn1

Synonyms:

• 1-(Thieno[3,2-d]pyrimidin-4-yl)piperidine-4-carbox

1-(Thieno[3,2-d]pyrimidin-4-yl)piperidine-4-carboxylic acid

CAS: 910037-25-1

1-(Thieno[3,2-d]pyrimidin-4-yl)piperidine-4-carboxylic acid

Purity: 97%

Color and Shape: Solid

Molecular weight: 263.32g/mol

Ref: 54-OR12221