CAS 910037-27-3

ethyl 1-thieno[3,2-d]pyrimidin-4-ylpiperidine-4-carboxylate

Description:

Ethyl 1-thieno[3,2-d]pyrimidin-4-ylpiperidine-4-carboxylate is a chemical compound characterized by its complex structure, which includes a thieno[3,2-d]pyrimidine ring fused with a piperidine moiety. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity due to its unique arrangement of nitrogen and sulfur atoms within the ring system. The presence of the ethyl ester functional group suggests that it may be soluble in organic solvents and could participate in various chemical reactions, including hydrolysis and esterification. Its molecular structure may confer specific pharmacological properties, making it of interest in medicinal chemistry for potential therapeutic applications. Additionally, the compound's CAS number, 910037-27-3, allows for its identification in chemical databases, facilitating research and development in various fields, including drug discovery and development. Overall, this compound represents a class of molecules that may have significant implications in pharmaceutical research.

Formula: C₁₄H₁₇N₃O₂S

InChI: InChI=1/C14H17N3O2S/c1-2-19-14(18)10-3-6-17(7-4-10)13-12-11(5-8-20-12)15-9-16-13/h5,8-10H,2-4,6-7H2,1H3

SMILES: CCOC(=O)C1CCN(CC1)c1c2c(ccs2)ncn1

Ethyl 1-(thieno[3,2-d]pyrimidin-4-yl)piperidine-4-carboxylate

CAS: 910037-27-3

Ethyl 1-(thieno[3,2-d]pyrimidin-4-yl)piperidine-4-carboxylate

Purity: ≥95%

Ref: 54-OR12253