
CAS 910037-29-5
:3-Amino-4-(methylamino)benzenemethanol
Description:
3-Amino-4-(methylamino)benzenemethanol, identified by its CAS number 910037-29-5, is an organic compound characterized by the presence of an amino group and a hydroxymethyl group attached to a benzene ring. This compound features a methylamino substituent, which contributes to its basicity and potential reactivity. The presence of both amino and hydroxymethyl groups suggests that it may participate in hydrogen bonding, influencing its solubility and interaction with other molecules. Typically, such compounds can exhibit biological activity, making them of interest in medicinal chemistry and drug development. The structural arrangement allows for various functional modifications, which can affect its pharmacological properties. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 3-Amino-4-(methylamino)benzenemethanol represents a class of compounds that may have applications in pharmaceuticals or as intermediates in organic synthesis.
Formula:C8H12N2O
InChI:InChI=1S/C8H12N2O/c1-10-8-3-2-6(5-11)4-7(8)9/h2-4,10-11H,5,9H2,1H3
InChI key:InChIKey=ZWGAKEBIGFXTSP-UHFFFAOYSA-N
SMILES:C(O)C1=CC(N)=C(NC)C=C1
Synonyms:- 3-Amino-4-(methylamino)benzenemethanol
- Benzenemethanol, 3-amino-4-(methylamino)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.