CAS 91004-48-7
:Benzoic acid,3,4-dimethoxy-5-nitro-
Description:
Benzoic acid, 3,4-dimethoxy-5-nitro- is an organic compound characterized by its aromatic structure, which includes a benzoic acid moiety substituted with methoxy and nitro groups. The presence of the methoxy groups at the 3 and 4 positions enhances its solubility in organic solvents and may influence its reactivity and biological activity. The nitro group at the 5 position introduces electron-withdrawing characteristics, which can affect the compound's acidity and reactivity in electrophilic substitution reactions. This compound is typically a solid at room temperature and may exhibit moderate to high stability under standard conditions. Its functional groups suggest potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. Additionally, the presence of both electron-donating (methoxy) and electron-withdrawing (nitro) groups can lead to interesting electronic properties, making it a subject of interest in various chemical research fields. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity or reactivity.
Formula:C9H9NO6
InChI:InChI=1S/C9H9NO6/c1-15-7-4-5(9(11)12)3-6(10(13)14)8(7)16-2/h3-4H,1-2H3,(H,11,12)
InChI key:GQNSKXYALDGGGN-UHFFFAOYSA-N
SMILES:COC1=CC(=CC(=C1OC)[N+](=O)[O-])C(=O)O
Synonyms:- Veratricacid, 5-nitro- (7CI)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3,4-Dimethoxy-5-nitrobenzoic acid
CAS:3,4-Dimethoxy-5-nitrobenzoic acidFormula:C9H9NO6Purity:>97%Molecular weight:227.173,4-Dimethoxy-5-nitrobenzoic acid
CAS:Formula:C9H9NO6Purity:98%Color and Shape:SolidMolecular weight:227.17093,4-Dimethoxy-5-nitrobenzoic acid
CAS:3,4-Dimethoxy-5-nitrobenzoic acidFormula:C9H9NO6Purity:97%Molecular weight:227.173,4-dimethoxy-5-nitrobenzoic acid
CAS:3,4-Dimethoxy-5-nitrobenzoic acid is a compound that can be used in the synthesis of pharmaceuticals. It has been shown to inhibit methylene amide demethylation and may have potential as an inhibitor of the enzyme catechol-o-methyltransferase. 3,4-Dimethoxy-5-nitrobenzoic acid is also used as a synthetic intermediate in the preparation process for other compounds. This chemical is bifunctional, with one functional group being electron rich and the other electron poor. The two functional groups are connected by a spacer molecule. Potassium is often used to prepare this chemical from its corresponding potassium salt.
Formula:C9H9NO6Purity:Min. 95%Molecular weight:227.2 g/mol




