CAS 91010-36-5
:N-methyl-1-(4-methylpyridin-2-yl)propan-2-amine
Description:
N-methyl-1-(4-methylpyridin-2-yl)propan-2-amine, with the CAS number 91010-36-5, is a chemical compound that belongs to the class of amines. It features a propan-2-amine backbone with a methyl group and a 4-methylpyridine moiety attached, which contributes to its unique properties. This compound is characterized by its basicity due to the presence of the amine functional group, which can participate in hydrogen bonding and protonation reactions. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of the pyridine ring imparts aromatic characteristics, influencing its solubility and reactivity. N-methyl-1-(4-methylpyridin-2-yl)propan-2-amine may exhibit biological activity, making it of interest in pharmaceutical research. Its stability and reactivity can vary based on environmental conditions, such as pH and temperature. Proper handling and storage are essential due to potential toxicity and the need for safety precautions when working with amines.
Formula:C10H16N2
InChI:InChI=1/C10H16N2/c1-8-4-5-12-10(6-8)7-9(2)11-3/h4-6,9,11H,7H2,1-3H3
SMILES:Cc1ccnc(c1)CC(C)NC
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.